C20H18F5N3 — CID 162588769
4-[2-(2,6-difluorocyclohexa-2,4-dien-1-ylidene)-1,7a-dihydroindol-5-yl]-4-ethylimino-1,1,1-trifluorobut-2-en-2-amine (PubChem CID 162588769) has the molecular formula C20H18F5N3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 4-[2-(2,6-difluorocyclohexa-2,4-dien-1-ylidene)-1,7a-dihydroindol-5-yl]-4-ethylimino-1,1,1-trifluorobut-2-en-2-amine.
| Compound Name | 4-[2-(2,6-difluorocyclohexa-2,4-dien-1-ylidene)-1,7a-dihydroindol-5-yl]-4-ethylimino-1,1,1-trifluorobut-2-en-2-amine |
|---|---|
| PubChem CID | 162588769 |
| Molecular Formula | C20H18F5N3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-[2-(2,6-difluorocyclohexa-2,4-dien-1-ylidene)-1,7a-dihydroindol-5-yl]-4-ethylimino-1,1,1-trifluorobut-2-en-2-amine |
| SMILES | CC/N=C(/C=C(N)C(F)(F)F)C1=CC2=CC(=C3C(F)=CC=CC3F)NC2C=C1 |
| InChI | InChI=1S/C20H18F5N3/c1-2-27-16(10-18(26)20(23,24)25)11-6-7-15-12(8-11)9-17(28-15)19-13(21)4-3-5-14(19)22/h3-10,13,15,28H,2,26H2,1H3/b18-10?,19-17?,27-16- |
| InChIKey | QZSYGKJOWILRST-JCPBHVQFSA-N |
| XLogP | 4.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|