About (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile
(4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile (PubChem CID 162588850) has the molecular formula C9H9F3N2O
and a molecular weight of 218.18 g/mol. Its IUPAC name is (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile.
Molecular Properties
| Compound Name | (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile |
| PubChem CID | 162588850 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile |
| SMILES | C=C(C#N)C/C=C\C(=C/N)OC(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O/c1-7(5-13)3-2-4-8(6-14)15-9(10,11)12/h2,4,6H,1,3,14H2/b4-2-,8-6+ |
| InChIKey | LUVJAXQNJZGPOD-XSHHVMTCSA-N |
| XLogP | 2.35 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile?
The IUPAC name of (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile (CID 162588850) is (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile.
What is the SMILES notation for (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile?
The canonical SMILES for (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile is C=C(C#N)C/C=C\C(=C/N)OC(F)(F)F.
What is the InChIKey of (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile?
The InChIKey is LUVJAXQNJZGPOD-XSHHVMTCSA-N. The full InChI is InChI=1S/C9H9F3N2O/c1-7(5-13)3-2-4-8(6-14)15-9(10,11)12/h2,4,6H,1,3,14H2/b4-2-,8-6+.
What are the key properties of (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile?
(4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile has a molecular weight of 218.18 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-7-amino-2-methylidene-6-(trifluoromethoxy)hepta-4,6-dienenitrile is sourced from PubChem (CID 162588850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).