C8H9F3N2O — CID 162589057
5,6-dimethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (PubChem CID 162589057) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 5,6-dimethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 162589057 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 5,6-dimethyl-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| SMILES | Cc1ncn(CC(F)(F)F)c(=O)c1C |
| InChI | InChI=1S/C8H9F3N2O/c1-5-6(2)12-4-13(7(5)14)3-8(9,10)11/h4H,3H2,1-2H3 |
| InChIKey | RNTKSFNGBUSPNL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |