C25H30F3N3O — CID 162589123
(3aR,8aR)-2-benzyl-3a-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-c]azepine-5-carboxamide (PubChem CID 162589123) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is (3aR,8aR)-2-benzyl-3a-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-c]azepine-5-carboxamide.
| Compound Name | (3aR,8aR)-2-benzyl-3a-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-c]azepine-5-carboxamide |
|---|---|
| PubChem CID | 162589123 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (3aR,8aR)-2-benzyl-3a-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[3,4-c]azepine-5-carboxamide |
| SMILES | C[C@]12CN(Cc3ccccc3)C[C@@H]1CCCN(C(=O)NCc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C25H30F3N3O/c1-24-17-30(15-20-6-3-2-4-7-20)16-22(24)8-5-13-31(18-24)23(32)29-14-19-9-11-21(12-10-19)25(26,27)28/h2-4,6-7,9-12,22H,5,8,13-18H2,1H3,(H,29,32)/t22-,24+/m0/s1 |
| InChIKey | CSFPXBYQQZXPHD-LADGPHEKSA-N |
| XLogP | 5.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |