C26H23F3IN5O — CID 162589777
5-[1-[[3-(3-iodoazetidin-1-yl)phenyl]methyl]-5-methylpyrazol-3-yl]-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]-1,2,4-oxadiazole (PubChem CID 162589777) has the molecular formula C26H23F3IN5O and a molecular weight of 605.40 g/mol. Its IUPAC name is 5-[1-[[3-(3-iodoazetidin-1-yl)phenyl]methyl]-5-methylpyrazol-3-yl]-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-[[3-(3-iodoazetidin-1-yl)phenyl]methyl]-5-methylpyrazol-3-yl]-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162589777 |
| Molecular Formula | C26H23F3IN5O |
| Molecular Weight | 605.40 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | 5-[1-[[3-(3-iodoazetidin-1-yl)phenyl]methyl]-5-methylpyrazol-3-yl]-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2nc(-c3ccc(C4(C(F)(F)F)CC4)cc3)no2)nn1Cc1cccc(N2CC(I)C2)c1 |
| InChI | InChI=1S/C26H23F3IN5O/c1-16-11-22(32-35(16)13-17-3-2-4-21(12-17)34-14-20(30)15-34)24-31-23(33-36-24)18-5-7-19(8-6-18)25(9-10-25)26(27,28)29/h2-8,11-12,20H,9-10,13-15H2,1H3 |
| InChIKey | RGPADGRPGCIIEZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|