C9H12F3N — CID 162589783
(2E)-N-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine (PubChem CID 162589783) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (2E)-N-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine.
| Compound Name | (2E)-N-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 162589783 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2E)-N-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)N(C)C(=C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-5-6-7(2)13(4)8(3)9(10,11)12/h5-6H,1,3H2,2,4H3/b7-6+ |
| InChIKey | CABRJUMWAVCKKT-VOTSOKGWSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|