About carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+)
carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) (PubChem CID 162589924) has the molecular formula C11H17F2NO3Os
and a molecular weight of 439.49 g/mol. Its IUPAC name is carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+).
Molecular Properties
| Compound Name | carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) |
| PubChem CID | 162589924 |
| Molecular Formula | C11H17F2NO3Os |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) |
| SMILES | O=C(NC1CCC2(CC1)OCCO2)[C-](F)F.[CH3-].[Os+2] |
| InChI | InChI=1S/C10H14F2NO3.CH3.Os/c11-8(12)9(14)13-7-1-3-10(4-2-7)15-5-6-16-10;;/h7H,1-6H2,(H,13,14);1H3;/q2*-1;+2 |
| InChIKey | QEGWSCKRKHODJF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+)?
The IUPAC name of carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) (CID 162589924) is carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+).
What is the SMILES notation for carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+)?
The canonical SMILES for carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) is O=C(NC1CCC2(CC1)OCCO2)[C-](F)F.[CH3-].[Os+2].
What is the InChIKey of carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+)?
The InChIKey is QEGWSCKRKHODJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2NO3.CH3.Os/c11-8(12)9(14)13-7-1-3-10(4-2-7)15-5-6-16-10;;/h7H,1-6H2,(H,13,14);1H3;/q2*-1;+2.
What are the key properties of carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+)?
carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) has a molecular weight of 439.49 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluoroacetamide;osmium(2+) is sourced from PubChem (CID 162589924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).