C32H35F3N6O3 — CID 162589932
4-amino-N-[(3R,6S)-6-(4,4-difluoropiperidine-1-carbonyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(pyridine-4-carboximidoyl)benzamide (PubChem CID 162589932) has the molecular formula C32H35F3N6O3 and a molecular weight of 608.67 g/mol. Its IUPAC name is 4-amino-N-[(3R,6S)-6-(4,4-difluoropiperidine-1-carbonyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(pyridine-4-carboximidoyl)benzamide.
| Compound Name | 4-amino-N-[(3R,6S)-6-(4,4-difluoropiperidine-1-carbonyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(pyridine-4-carboximidoyl)benzamide |
|---|---|
| PubChem CID | 162589932 |
| Molecular Formula | C32H35F3N6O3 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 4-amino-N-[(3R,6S)-6-(4,4-difluoropiperidine-1-carbonyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(pyridine-4-carboximidoyl)benzamide |
| SMILES | [H]/N=C(\c1ccncc1)c1cc(C(=O)N[C@@H]2CC[C@@H](C(=O)N3CCC(F)(F)CC3)N(Cc3c(F)cccc3OC)C2)ccc1N |
| InChI | InChI=1S/C32H35F3N6O3/c1-44-28-4-2-3-25(33)24(28)19-41-18-22(6-8-27(41)31(43)40-15-11-32(34,35)12-16-40)39-30(42)21-5-7-26(36)23(17-21)29(37)20-9-13-38-14-10-20/h2-5,7,9-10,13-14,17,22,27,37H,6,8,11-12,15-16,18-19,36H2,1H3,(H,39,42)/b37-29+/t22-,27+/m1/s1 |
| InChIKey | GIFOZXXVPXQDGQ-SDIHSYSKSA-N |
| XLogP | 4.25 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|