C10H14F3N — CID 162589953
(3E,5R)-1,1,1-trifluoro-4,5-dimethylocta-3,7-dien-2-imine (PubChem CID 162589953) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (3E,5R)-1,1,1-trifluoro-4,5-dimethylocta-3,7-dien-2-imine.
| Compound Name | (3E,5R)-1,1,1-trifluoro-4,5-dimethylocta-3,7-dien-2-imine |
|---|---|
| PubChem CID | 162589953 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3E,5R)-1,1,1-trifluoro-4,5-dimethylocta-3,7-dien-2-imine |
| SMILES | [H]/N=C(\C=C(/C)[C@H](C)CC=C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-4-5-7(2)8(3)6-9(14)10(11,12)13/h4,6-7,14H,1,5H2,2-3H3/b8-6+,14-9+/t7-/m1/s1 |
| InChIKey | XGHQTZMRYUPOIG-KNKVCCJPSA-N |
| XLogP | 3.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|