C23H25F3N8O — CID 162590224
N-methyl-4-(methylideneamino)-N-phenyl-6-[5-[(1R,5S)-8-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-yl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazin-2-amine (PubChem CID 162590224) has the molecular formula C23H25F3N8O and a molecular weight of 486.50 g/mol. Its IUPAC name is N-methyl-4-(methylideneamino)-N-phenyl-6-[5-[(1R,5S)-8-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-yl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-methyl-4-(methylideneamino)-N-phenyl-6-[5-[(1R,5S)-8-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-yl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162590224 |
| Molecular Formula | C23H25F3N8O |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-methyl-4-(methylideneamino)-N-phenyl-6-[5-[(1R,5S)-8-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-yl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazin-2-amine |
| SMILES | C=Nc1nc(-c2noc(C3C[C@H]4CC[C@@H](C3)N4CCC(F)(F)F)n2)nc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C23H25F3N8O/c1-27-21-29-18(30-22(31-21)33(2)15-6-4-3-5-7-15)19-28-20(35-32-19)14-12-16-8-9-17(13-14)34(16)11-10-23(24,25)26/h3-7,14,16-17H,1,8-13H2,2H3/t14?,16-,17+ |
| InChIKey | OHACNAWEHMFXCM-ZXFUBFMLSA-N |
| XLogP | 4.68 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|