About (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine
(E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine (PubChem CID 162590268) has the molecular formula C9H16F3N
and a molecular weight of 195.23 g/mol. Its IUPAC name is (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine |
| PubChem CID | 162590268 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine |
| SMILES | CC(C)(C)C/C=C(\CN)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N/c1-8(2,3)5-4-7(6-13)9(10,11)12/h4H,5-6,13H2,1-3H3/b7-4+ |
| InChIKey | ZIFBWIUSMRELTE-QPJJXVBHSA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine?
The IUPAC name of (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine (CID 162590268) is (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine.
What is the SMILES notation for (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine?
The canonical SMILES for (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine is CC(C)(C)C/C=C(\CN)C(F)(F)F.
What is the InChIKey of (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine?
The InChIKey is ZIFBWIUSMRELTE-QPJJXVBHSA-N. The full InChI is InChI=1S/C9H16F3N/c1-8(2,3)5-4-7(6-13)9(10,11)12/h4H,5-6,13H2,1-3H3/b7-4+.
What are the key properties of (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine?
(E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine has a molecular weight of 195.23 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-dimethyl-2-(trifluoromethyl)hex-2-en-1-amine is sourced from PubChem (CID 162590268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).