C10H16ClF3O — CID 162590684
(E,7R)-7-chloro-1,1,1-trifluoro-3,4-dimethyloct-3-en-2-ol (PubChem CID 162590684) has the molecular formula C10H16ClF3O and a molecular weight of 244.68 g/mol. Its IUPAC name is (E,7R)-7-chloro-1,1,1-trifluoro-3,4-dimethyloct-3-en-2-ol.
| Compound Name | (E,7R)-7-chloro-1,1,1-trifluoro-3,4-dimethyloct-3-en-2-ol |
|---|---|
| PubChem CID | 162590684 |
| Molecular Formula | C10H16ClF3O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (E,7R)-7-chloro-1,1,1-trifluoro-3,4-dimethyloct-3-en-2-ol |
| SMILES | C/C(CC[C@@H](C)Cl)=C(/C)C(O)C(F)(F)F |
| InChI | InChI=1S/C10H16ClF3O/c1-6(4-5-7(2)11)8(3)9(15)10(12,13)14/h7,9,15H,4-5H2,1-3H3/b8-6+/t7-,9?/m1/s1 |
| InChIKey | XNJDHESOXQEYDT-CPPZRPHLSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|