C17H21F2NO2 — CID 162590688
(7E)-4,4-difluoro-7-hydroxy-8-(2,4,6-trimethylphenyl)-2,3,5,6-tetrahydro-1H-azonin-9-one (PubChem CID 162590688) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is (7E)-4,4-difluoro-7-hydroxy-8-(2,4,6-trimethylphenyl)-2,3,5,6-tetrahydro-1H-azonin-9-one.
| Compound Name | (7E)-4,4-difluoro-7-hydroxy-8-(2,4,6-trimethylphenyl)-2,3,5,6-tetrahydro-1H-azonin-9-one |
|---|---|
| PubChem CID | 162590688 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (7E)-4,4-difluoro-7-hydroxy-8-(2,4,6-trimethylphenyl)-2,3,5,6-tetrahydro-1H-azonin-9-one |
| SMILES | Cc1cc(C)c(/C2=C(\O)CCC(F)(F)CCNC2=O)c(C)c1 |
| InChI | InChI=1S/C17H21F2NO2/c1-10-8-11(2)14(12(3)9-10)15-13(21)4-5-17(18,19)6-7-20-16(15)22/h8-9,21H,4-7H2,1-3H3,(H,20,22)/b15-13+ |
| InChIKey | JPNCGFXXAIEPCH-FYWRMAATSA-N |
| XLogP | 3.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |