C24H23F3N6O2 — CID 162590938
(2R)-1-[2-[6-[(1R)-2,2,2-trifluoro-1-(3-iminopyrrolidin-1-yl)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-2-ol (PubChem CID 162590938) has the molecular formula C24H23F3N6O2 and a molecular weight of 484.48 g/mol. Its IUPAC name is (2R)-1-[2-[6-[(1R)-2,2,2-trifluoro-1-(3-iminopyrrolidin-1-yl)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-2-ol.
| Compound Name | (2R)-1-[2-[6-[(1R)-2,2,2-trifluoro-1-(3-iminopyrrolidin-1-yl)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 162590938 |
| Molecular Formula | C24H23F3N6O2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (2R)-1-[2-[6-[(1R)-2,2,2-trifluoro-1-(3-iminopyrrolidin-1-yl)ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-2-ol |
| SMILES | [H]/N=C1\CCN([C@H](c2ccc3nnc(-c4ccc5cccc(OC[C@@H](C)O)c5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C24H23F3N6O2/c1-14(34)13-35-19-4-2-3-15-5-7-18(29-21(15)19)23-31-30-20-8-6-16(11-33(20)23)22(24(25,26)27)32-10-9-17(28)12-32/h2-8,11,14,22,28,34H,9-10,12-13H2,1H3/b28-17+/t14-,22-/m1/s1 |
| InChIKey | XPCPUUBMBKDHFA-BRSYNTPQSA-N |
| XLogP | 4.03 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|