C19H30F2O3Si — CID 162591066
ethyl 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4,5-tetrahydro-1H-inden-4-yl]-2,2-difluoroacetate (PubChem CID 162591066) has the molecular formula C19H30F2O3Si and a molecular weight of 372.53 g/mol. Its IUPAC name is ethyl 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4,5-tetrahydro-1H-inden-4-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4,5-tetrahydro-1H-inden-4-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162591066 |
| Molecular Formula | C19H30F2O3Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | ethyl 2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4,5-tetrahydro-1H-inden-4-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)C1CC=CC2=C1CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30F2O3Si/c1-7-23-17(22)19(20,21)15-10-8-9-14-13(15)11-12-16(14)24-25(5,6)18(2,3)4/h8-9,15-16H,7,10-12H2,1-6H3/t15?,16-/m0/s1 |
| InChIKey | BOBVSLKWWSCMGD-LYKKTTPLSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|