About cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol
cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol (PubChem CID 162591749) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol |
| PubChem CID | 162591749 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol |
| SMILES | [H]/N=C(\CO)[C@H]1CC(F)(F)C[C@H]1O |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)1-4(5(10)3-11)6(12)2-7/h4,6,10-12H,1-3H2/b10-5+/t4-,6-/m1/s1 |
| InChIKey | GFUXHKUHPMECRR-GUNZWFBQSA-N |
| XLogP | 0.40 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol?
The IUPAC name of cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol (CID 162591749) is cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol.
What is the SMILES notation for cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol?
The canonical SMILES for cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol is [H]/N=C(\CO)[C@H]1CC(F)(F)C[C@H]1O.
What is the InChIKey of cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol?
The InChIKey is GFUXHKUHPMECRR-GUNZWFBQSA-N. The full InChI is InChI=1S/C7H11F2NO2/c8-7(9)1-4(5(10)3-11)6(12)2-7/h4,6,10-12H,1-3H2/b10-5+/t4-,6-/m1/s1.
What are the key properties of cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol?
cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol has a molecular weight of 179.17 g/mol, XLogP of 0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-4,4-difluoro-2-(2-hydroxyethanimidoyl)cyclopentan-1-ol is sourced from PubChem (CID 162591749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).