C25H31F2O7S2+ — CID 162592068
1,1-difluoro-2-[[3-[1-(1,4-oxathian-4-ium-4-yl)-2-oxo-2-phenylethyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 162592068) has the molecular formula C25H31F2O7S2+ and a molecular weight of 545.65 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-[1-(1,4-oxathian-4-ium-4-yl)-2-oxo-2-phenylethyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[3-[1-(1,4-oxathian-4-ium-4-yl)-2-oxo-2-phenylethyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 162592068 |
| Molecular Formula | C25H31F2O7S2+ |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 1,1-difluoro-2-[[3-[1-(1,4-oxathian-4-ium-4-yl)-2-oxo-2-phenylethyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(c1ccccc1)C([S+]1CCOCC1)C12CC3CC(CC(COC(=O)C(F)(F)S(=O)(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C25H30F2O7S2/c26-25(27,36(30,31)32)22(29)34-16-23-11-17-10-18(12-23)14-24(13-17,15-23)21(35-8-6-33-7-9-35)20(28)19-4-2-1-3-5-19/h1-5,17-18,21H,6-16H2/p+1 |
| InChIKey | OYBKEHSWUPEBOB-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|