C34H35F3N4O3S — CID 162592420
2-[[4-[(E)-1,1-difluorobut-2-enyl]phenyl]methyl]-N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide (PubChem CID 162592420) has the molecular formula C34H35F3N4O3S and a molecular weight of 636.74 g/mol. Its IUPAC name is 2-[[4-[(E)-1,1-difluorobut-2-enyl]phenyl]methyl]-N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide.
| Compound Name | 2-[[4-[(E)-1,1-difluorobut-2-enyl]phenyl]methyl]-N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 162592420 |
| Molecular Formula | C34H35F3N4O3S |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 2-[[4-[(E)-1,1-difluorobut-2-enyl]phenyl]methyl]-N-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
| SMILES | C/C=C/C(F)(F)c1ccc(CN2CCc3[nH]c4ccc(C(=O)NC5CCN(S(=O)(=O)c6ccc(F)cc6)CC5)cc4c3C2)cc1 |
| InChI | InChI=1S/C34H35F3N4O3S/c1-2-16-34(36,37)25-6-3-23(4-7-25)21-40-17-15-32-30(22-40)29-20-24(5-12-31(29)39-32)33(42)38-27-13-18-41(19-14-27)45(43,44)28-10-8-26(35)9-11-28/h2-12,16,20,27,39H,13-15,17-19,21-22H2,1H3,(H,38,42)/b16-2+ |
| InChIKey | MMPGYTHGYWHUBB-APQPDGGLSA-N |
| XLogP | 6.12 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|