C25H32F3NO6 — CID 162592576
methyl N-[(E,5S)-5-[4-hydroxy-6-oxo-5-[(2E,4Z)-10,10,10-trifluoro-2,5-dimethyldeca-2,4-dienoyl]pyran-2-yl]hex-1-enyl]carbamate (PubChem CID 162592576) has the molecular formula C25H32F3NO6 and a molecular weight of 499.53 g/mol. Its IUPAC name is methyl N-[(E,5S)-5-[4-hydroxy-6-oxo-5-[(2E,4Z)-10,10,10-trifluoro-2,5-dimethyldeca-2,4-dienoyl]pyran-2-yl]hex-1-enyl]carbamate.
| Compound Name | methyl N-[(E,5S)-5-[4-hydroxy-6-oxo-5-[(2E,4Z)-10,10,10-trifluoro-2,5-dimethyldeca-2,4-dienoyl]pyran-2-yl]hex-1-enyl]carbamate |
|---|---|
| PubChem CID | 162592576 |
| Molecular Formula | C25H32F3NO6 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | methyl N-[(E,5S)-5-[4-hydroxy-6-oxo-5-[(2E,4Z)-10,10,10-trifluoro-2,5-dimethyldeca-2,4-dienoyl]pyran-2-yl]hex-1-enyl]carbamate |
| SMILES | COC(=O)N/C=C/CC[C@H](C)c1cc(O)c(C(=O)/C(C)=C/C=C(/C)CCCCC(F)(F)F)c(=O)o1 |
| InChI | InChI=1S/C25H32F3NO6/c1-16(9-5-7-13-25(26,27)28)11-12-18(3)22(31)21-19(30)15-20(35-23(21)32)17(2)10-6-8-14-29-24(33)34-4/h8,11-12,14-15,17,30H,5-7,9-10,13H2,1-4H3,(H,29,33)/b14-8+,16-11-,18-12+/t17-/m0/s1 |
| InChIKey | FLOUQRLLQRHJOU-MTQLHVAFSA-N |
| XLogP | 6.30 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|