C14H19F6NO — CID 162592682
1,1,1,3,3,3-hexafluoro-2-[5-methyl-4-[(propan-2-ylamino)methyl]cyclohexa-1,3-dien-1-yl]propan-2-ol (PubChem CID 162592682) has the molecular formula C14H19F6NO and a molecular weight of 331.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[5-methyl-4-[(propan-2-ylamino)methyl]cyclohexa-1,3-dien-1-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[5-methyl-4-[(propan-2-ylamino)methyl]cyclohexa-1,3-dien-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 162592682 |
| Molecular Formula | C14H19F6NO |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[5-methyl-4-[(propan-2-ylamino)methyl]cyclohexa-1,3-dien-1-yl]propan-2-ol |
| SMILES | CC(C)NCC1=CC=C(C(O)(C(F)(F)F)C(F)(F)F)CC1C |
| InChI | InChI=1S/C14H19F6NO/c1-8(2)21-7-10-4-5-11(6-9(10)3)12(22,13(15,16)17)14(18,19)20/h4-5,8-9,21-22H,6-7H2,1-3H3 |
| InChIKey | JKLDSHYUQGUDMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |