C9H10F4IN — CID 162592711
7-fluoro-3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 162592711) has the molecular formula C9H10F4IN and a molecular weight of 335.08 g/mol. Its IUPAC name is 7-fluoro-3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 7-fluoro-3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 162592711 |
| Molecular Formula | C9H10F4IN |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 7-fluoro-3-iodo-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | FC1CC(C(F)(F)F)CC2C(I)=CNC12 |
| InChI | InChI=1S/C9H10F4IN/c10-6-2-4(9(11,12)13)1-5-7(14)3-15-8(5)6/h3-6,8,15H,1-2H2 |
| InChIKey | DHNJZOPVTHKVSA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|