C7H12F6N2 — CID 162592813
2-N,2-N'-diethyl-1,1,1,3,3,3-hexafluoropropane-2,2-diamine (PubChem CID 162592813) has the molecular formula C7H12F6N2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 2-N,2-N'-diethyl-1,1,1,3,3,3-hexafluoropropane-2,2-diamine.
| Compound Name | 2-N,2-N'-diethyl-1,1,1,3,3,3-hexafluoropropane-2,2-diamine |
|---|---|
| PubChem CID | 162592813 |
| Molecular Formula | C7H12F6N2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-N,2-N'-diethyl-1,1,1,3,3,3-hexafluoropropane-2,2-diamine |
| SMILES | CCNC(NCC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H12F6N2/c1-3-14-5(15-4-2,6(8,9)10)7(11,12)13/h14-15H,3-4H2,1-2H3 |
| InChIKey | DWRWGZPZEQVZKF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|