C26H35F3IN3O2 — CID 162592891
N-[(1S)-1-[4-[1-[6-[3,3-difluorobutyl(ethyl)-λ3-iodanyl]-3-fluoro-5-methyl-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide (PubChem CID 162592891) has the molecular formula C26H35F3IN3O2 and a molecular weight of 605.48 g/mol. Its IUPAC name is N-[(1S)-1-[4-[1-[6-[3,3-difluorobutyl(ethyl)-λ3-iodanyl]-3-fluoro-5-methyl-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[4-[1-[6-[3,3-difluorobutyl(ethyl)-λ3-iodanyl]-3-fluoro-5-methyl-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 162592891 |
| Molecular Formula | C26H35F3IN3O2 |
| Molecular Weight | 605.48 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | N-[(1S)-1-[4-[1-[6-[3,3-difluorobutyl(ethyl)-λ3-iodanyl]-3-fluoro-5-methyl-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
| SMILES | CCI(CCC(C)(F)F)c1nc(N2CCC(Oc3ccc([C@H](C)NC(C)=O)cc3)C2)c(F)cc1C |
| InChI | InChI=1S/C26H35F3IN3O2/c1-6-30(13-12-26(5,28)29)24-17(2)15-23(27)25(32-24)33-14-11-22(16-33)35-21-9-7-20(8-10-21)18(3)31-19(4)34/h7-10,15,18,22H,6,11-14,16H2,1-5H3,(H,31,34)/t18-,22?/m0/s1 |
| InChIKey | AZGFKKYNSATXRP-HXBUSHRASA-N |
| XLogP | 6.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|