About N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine
N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine (PubChem CID 162592896) has the molecular formula C9H10F3NO
and a molecular weight of 205.18 g/mol. Its IUPAC name is N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 162592896 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine |
| SMILES | C=C1C=C(OC(F)(F)F)C=CC1NC |
| InChI | InChI=1S/C9H10F3NO/c1-6-5-7(14-9(10,11)12)3-4-8(6)13-2/h3-5,8,13H,1H2,2H3 |
| InChIKey | RJFISLAIXOWNGY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine?
The IUPAC name of N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine (CID 162592896) is N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine is C=C1C=C(OC(F)(F)F)C=CC1NC.
What is the InChIKey of N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine?
The InChIKey is RJFISLAIXOWNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO/c1-6-5-7(14-9(10,11)12)3-4-8(6)13-2/h3-5,8,13H,1H2,2H3.
What are the key properties of N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine?
N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine has a molecular weight of 205.18 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-methylidene-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 162592896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).