C29H28F2O10 — CID 162592955
(2R,4R,5S)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162592955) has the molecular formula C29H28F2O10 and a molecular weight of 574.53 g/mol. Its IUPAC name is (2R,4R,5S)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4R,5S)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162592955 |
| Molecular Formula | C29H28F2O10 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (2R,4R,5S)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1O[C@H](C#Cc2ccc3c(c2)C(F)(F)c2cc(C#C[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)ccc2-3)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H28F2O10/c30-29(31)17-9-13(3-7-19-23(34)27(38)25(36)21(11-32)40-19)1-5-15(17)16-6-2-14(10-18(16)29)4-8-20-24(35)28(39)26(37)22(12-33)41-20/h1-2,5-6,9-10,19-28,32-39H,11-12H2/t19-,20-,21-,22?,23-,24?,25-,26-,27-,28-/m1/s1 |
| InChIKey | SCVRGJRIYIXEOA-DVMOZASASA-N |
| XLogP | -1.81 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|