C23H30F3N3O2 — CID 162593013
8-ethyl-3-methylidene-2-(piperidin-4-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]isoquinoline-7-carboxamide (PubChem CID 162593013) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 8-ethyl-3-methylidene-2-(piperidin-4-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]isoquinoline-7-carboxamide.
| Compound Name | 8-ethyl-3-methylidene-2-(piperidin-4-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 162593013 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 8-ethyl-3-methylidene-2-(piperidin-4-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]isoquinoline-7-carboxamide |
| SMILES | C=C1C=c2ccc(C(=O)NCCOCC(F)(F)F)c(CC)c2=CN1CC1CCNCC1 |
| InChI | InChI=1S/C23H30F3N3O2/c1-3-19-20(22(30)28-10-11-31-15-23(24,25)26)5-4-18-12-16(2)29(14-21(18)19)13-17-6-8-27-9-7-17/h4-5,12,14,17,27H,2-3,6-11,13,15H2,1H3,(H,28,30) |
| InChIKey | SWAOVLFCAWPLAS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|