C7H9F3N4 — CID 162593219
(1S)-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]but-3-en-1-amine (PubChem CID 162593219) has the molecular formula C7H9F3N4 and a molecular weight of 206.17 g/mol. Its IUPAC name is (1S)-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]but-3-en-1-amine.
| Compound Name | (1S)-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]but-3-en-1-amine |
|---|---|
| PubChem CID | 162593219 |
| Molecular Formula | C7H9F3N4 |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (1S)-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H9F3N4/c1-2-3-4(11)5-12-6(14-13-5)7(8,9)10/h2,4H,1,3,11H2,(H,12,13,14)/t4-/m0/s1 |
| InChIKey | CKHJBBCRHKWLHN-BYPYZUCNSA-N |
| XLogP | 1.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|