C21H27F3N4O — CID 162593324
(5-ethyl-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-3-yl)-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 162593324) has the molecular formula C21H27F3N4O and a molecular weight of 408.47 g/mol. Its IUPAC name is (5-ethyl-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-3-yl)-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | (5-ethyl-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-3-yl)-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 162593324 |
| Molecular Formula | C21H27F3N4O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (5-ethyl-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-3-yl)-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | CCN1CCC2NN=C(C(=O)N3CCC(c4ccccc4C(F)(F)F)CC3)C2C1 |
| InChI | InChI=1S/C21H27F3N4O/c1-2-27-10-9-18-16(13-27)19(26-25-18)20(29)28-11-7-14(8-12-28)15-5-3-4-6-17(15)21(22,23)24/h3-6,14,16,18,25H,2,7-13H2,1H3 |
| InChIKey | MPOMWEMHMOBTKD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |