C21H32F2N4O — CID 162594369
1-[6-(1,1-difluorobutyl)-3,3-dimethyl-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 162594369) has the molecular formula C21H32F2N4O and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-[6-(1,1-difluorobutyl)-3,3-dimethyl-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[6-(1,1-difluorobutyl)-3,3-dimethyl-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 162594369 |
| Molecular Formula | C21H32F2N4O |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-[6-(1,1-difluorobutyl)-3,3-dimethyl-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | CCCC(F)(F)c1cc2c(cn1)C(C)(C)CN2C(=O)CN1C[C@@H](C)NC[C@@H]1C |
| InChI | InChI=1S/C21H32F2N4O/c1-6-7-21(22,23)18-8-17-16(10-25-18)20(4,5)13-27(17)19(28)12-26-11-14(2)24-9-15(26)3/h8,10,14-15,24H,6-7,9,11-13H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | ZCOBDQLOMNALPD-CABCVRRESA-N |
| XLogP | 3.28 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |