C19H27F3N2O4 — CID 162594379
(3R,7aR)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-7-hydroxy-7a-methyl-5-oxo-3-(trifluoromethyl)-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxamide (PubChem CID 162594379) has the molecular formula C19H27F3N2O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is (3R,7aR)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-7-hydroxy-7a-methyl-5-oxo-3-(trifluoromethyl)-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxamide.
| Compound Name | (3R,7aR)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-7-hydroxy-7a-methyl-5-oxo-3-(trifluoromethyl)-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 162594379 |
| Molecular Formula | C19H27F3N2O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (3R,7aR)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-7-hydroxy-7a-methyl-5-oxo-3-(trifluoromethyl)-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
| SMILES | CC1(C)C2CCC(CNC(=O)C3C(=O)N4[C@@H](C(F)(F)F)OC[C@]4(C)C3O)C1C2 |
| InChI | InChI=1S/C19H27F3N2O4/c1-17(2)10-5-4-9(11(17)6-10)7-23-14(26)12-13(25)18(3)8-28-16(19(20,21)22)24(18)15(12)27/h9-13,16,25H,4-8H2,1-3H3,(H,23,26)/t9?,10?,11?,12?,13?,16-,18-/m1/s1 |
| InChIKey | MQOGWOIMKNMOLL-VAWBNNTPSA-N |
| XLogP | 1.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|