C9H14F5N5O6S — CID 162594406
[(E)-3-hydrazinyl-3-nitro-2-[[2-oxo-2-(2,2,3,3,3-pentafluoropropylamino)ethyl]amino]prop-2-enyl] methanesulfonate (PubChem CID 162594406) has the molecular formula C9H14F5N5O6S and a molecular weight of 415.30 g/mol. Its IUPAC name is [(E)-3-hydrazinyl-3-nitro-2-[[2-oxo-2-(2,2,3,3,3-pentafluoropropylamino)ethyl]amino]prop-2-enyl] methanesulfonate.
| Compound Name | [(E)-3-hydrazinyl-3-nitro-2-[[2-oxo-2-(2,2,3,3,3-pentafluoropropylamino)ethyl]amino]prop-2-enyl] methanesulfonate |
|---|---|
| PubChem CID | 162594406 |
| Molecular Formula | C9H14F5N5O6S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [(E)-3-hydrazinyl-3-nitro-2-[[2-oxo-2-(2,2,3,3,3-pentafluoropropylamino)ethyl]amino]prop-2-enyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC/C(NCC(=O)NCC(F)(F)C(F)(F)F)=C(/NN)[N+](=O)[O-] |
| InChI | InChI=1S/C9H14F5N5O6S/c1-26(23,24)25-3-5(7(18-15)19(21)22)16-2-6(20)17-4-8(10,11)9(12,13)14/h16,18H,2-4,15H2,1H3,(H,17,20)/b7-5+ |
| InChIKey | YSJWWPITLTYUHD-FNORWQNLSA-N |
| XLogP | -1.22 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|