C9H13F2NO — CID 162594467
(3aR,6aR)-5-ethyl-4,4-difluoro-3-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole (PubChem CID 162594467) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is (3aR,6aR)-5-ethyl-4,4-difluoro-3-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole.
| Compound Name | (3aR,6aR)-5-ethyl-4,4-difluoro-3-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole |
|---|---|
| PubChem CID | 162594467 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (3aR,6aR)-5-ethyl-4,4-difluoro-3-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole |
| SMILES | CCC1C[C@H]2ON=C(C)[C@H]2C1(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-3-6-4-7-8(9(6,10)11)5(2)12-13-7/h6-8H,3-4H2,1-2H3/t6?,7-,8-/m1/s1 |
| InChIKey | PUAMIFMRGCWHMT-SPDVFEMOSA-N |
| XLogP | 2.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |