C7H9F3N2 — CID 162594744
N,N'-bis(ethenyl)-2,2,2-trifluoro-N-methylethanimidamide (PubChem CID 162594744) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is N,N'-bis(ethenyl)-2,2,2-trifluoro-N-methylethanimidamide.
| Compound Name | N,N'-bis(ethenyl)-2,2,2-trifluoro-N-methylethanimidamide |
|---|---|
| PubChem CID | 162594744 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N,N'-bis(ethenyl)-2,2,2-trifluoro-N-methylethanimidamide |
| SMILES | C=C/N=C(\N(C)C=C)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-4-11-6(7(8,9)10)12(3)5-2/h4-5H,1-2H2,3H3/b11-6- |
| InChIKey | XXFWIADDXQRHJA-WDZFZDKYSA-N |
| XLogP | 2.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|