About (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine
(Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine (PubChem CID 162595351) has the molecular formula C9H10F6N2
and a molecular weight of 260.18 g/mol. Its IUPAC name is (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine.
Molecular Properties
| Compound Name | (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine |
| PubChem CID | 162595351 |
| Molecular Formula | C9H10F6N2 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C(=C(C(\C)=N\C)/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6N2/c1-4(16)6(8(10,11)12)7(5(2)17-3)9(13,14)15/h16H,1-3H3/b7-6-,16-4+,17-5+ |
| InChIKey | IZZGPCKTLSTUJI-DTLJBDGYSA-N |
| XLogP | 3.54 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine?
The IUPAC name of (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine (CID 162595351) is (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine.
What is the SMILES notation for (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine?
The canonical SMILES for (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine is [H]/N=C(C)/C(=C(C(\C)=N\C)/C(F)(F)F)C(F)(F)F.
What is the InChIKey of (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine?
The InChIKey is IZZGPCKTLSTUJI-DTLJBDGYSA-N. The full InChI is InChI=1S/C9H10F6N2/c1-4(16)6(8(10,11)12)7(5(2)17-3)9(13,14)15/h16H,1-3H3/b7-6-,16-4+,17-5+.
What are the key properties of (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine?
(Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine has a molecular weight of 260.18 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-N-methyl-3,4-bis(trifluoromethyl)hex-3-ene-2,5-diimine is sourced from PubChem (CID 162595351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).