C21H29F6N5O4 — CID 162596533
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(aminomethylidene)-3-ethylimino-4-morpholin-4-yl-4-oxobutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 162596533) has the molecular formula C21H29F6N5O4 and a molecular weight of 529.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(aminomethylidene)-3-ethylimino-4-morpholin-4-yl-4-oxobutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(aminomethylidene)-3-ethylimino-4-morpholin-4-yl-4-oxobutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 162596533 |
| Molecular Formula | C21H29F6N5O4 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[2-(aminomethylidene)-3-ethylimino-4-morpholin-4-yl-4-oxobutyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC/N=C(/C(=O)N1CCOCC1)C(=CN)CN1CC2CN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2C1 |
| InChI | InChI=1S/C21H29F6N5O4/c1-2-29-16(17(33)31-3-5-35-6-4-31)13(7-28)8-30-9-14-11-32(12-15(14)10-30)19(34)36-18(20(22,23)24)21(25,26)27/h7,14-15,18H,2-6,8-12,28H2,1H3/b13-7?,29-16+ |
| InChIKey | KZDAATBQKFOMED-MVXOVWBOSA-N |
| XLogP | 1.64 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|