About 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane
2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane (PubChem CID 162596889) has the molecular formula C13H23F3O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane.
Molecular Properties
| Compound Name | 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane |
| PubChem CID | 162596889 |
| Molecular Formula | C13H23F3O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane |
| SMILES | CC[C@H](C(C)OC1CCCCO1)C(C)C(F)(F)F |
| InChI | InChI=1S/C13H23F3O2/c1-4-11(9(2)13(14,15)16)10(3)18-12-7-5-6-8-17-12/h9-12H,4-8H2,1-3H3/t9?,10?,11-,12?/m0/s1 |
| InChIKey | AUGAIQVGKXSBBS-FYJQFVIDSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane?
The IUPAC name of 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane (CID 162596889) is 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane.
What is the SMILES notation for 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane?
The canonical SMILES for 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane is CC[C@H](C(C)OC1CCCCO1)C(C)C(F)(F)F.
What is the InChIKey of 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane?
The InChIKey is AUGAIQVGKXSBBS-FYJQFVIDSA-N. The full InChI is InChI=1S/C13H23F3O2/c1-4-11(9(2)13(14,15)16)10(3)18-12-7-5-6-8-17-12/h9-12H,4-8H2,1-3H3/t9?,10?,11-,12?/m0/s1.
What are the key properties of 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane?
2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane has a molecular weight of 268.32 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-ethyl-5,5,5-trifluoro-4-methylpentan-2-yl]oxyoxane is sourced from PubChem (CID 162596889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).