C10H8F3NOS — CID 162597223
(Z)-1-(6,7-dihydro-1,3-benzothiazol-2-yl)-3,3,3-trifluoroprop-1-en-2-ol (PubChem CID 162597223) has the molecular formula C10H8F3NOS and a molecular weight of 247.24 g/mol. Its IUPAC name is (Z)-1-(6,7-dihydro-1,3-benzothiazol-2-yl)-3,3,3-trifluoroprop-1-en-2-ol.
| Compound Name | (Z)-1-(6,7-dihydro-1,3-benzothiazol-2-yl)-3,3,3-trifluoroprop-1-en-2-ol |
|---|---|
| PubChem CID | 162597223 |
| Molecular Formula | C10H8F3NOS |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (Z)-1-(6,7-dihydro-1,3-benzothiazol-2-yl)-3,3,3-trifluoroprop-1-en-2-ol |
| SMILES | O/C(=C\c1nc2c(s1)CCC=C2)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NOS/c11-10(12,13)8(15)5-9-14-6-3-1-2-4-7(6)16-9/h1,3,5,15H,2,4H2/b8-5- |
| InChIKey | XAQPTYJKEHMMNY-YVMONPNESA-N |
| XLogP | 3.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|