C12H13F6N2- — CID 162597379
[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-[cyclopropyl(methyl)amino]azanide (PubChem CID 162597379) has the molecular formula C12H13F6N2- and a molecular weight of 299.24 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-[cyclopropyl(methyl)amino]azanide.
| Compound Name | [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-[cyclopropyl(methyl)amino]azanide |
|---|---|
| PubChem CID | 162597379 |
| Molecular Formula | C12H13F6N2- |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-[cyclopropyl(methyl)amino]azanide |
| SMILES | CN([N-]C1C=C(C(F)(F)F)C=C(C(F)(F)F)C1)C1CC1 |
| InChI | InChI=1S/C12H13F6N2/c1-20(10-2-3-10)19-9-5-7(11(13,14)15)4-8(6-9)12(16,17)18/h4-5,9-10H,2-3,6H2,1H3/q-1 |
| InChIKey | OQBAKUGQPBRHIJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|