About N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine
N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 162597458) has the molecular formula C13H19F3N2
and a molecular weight of 260.30 g/mol. Its IUPAC name is N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 162597458 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | FC(F)(F)C1=CC(NCC2CCCCN2)=CCC1 |
| InChI | InChI=1S/C13H19F3N2/c14-13(15,16)10-4-3-6-11(8-10)18-9-12-5-1-2-7-17-12/h6,8,12,17-18H,1-5,7,9H2 |
| InChIKey | GTVCARYVTRAMHI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (CID 162597458) is N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is FC(F)(F)C1=CC(NCC2CCCCN2)=CCC1.
What is the InChIKey of N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is GTVCARYVTRAMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2/c14-13(15,16)10-4-3-6-11(8-10)18-9-12-5-1-2-7-17-12/h6,8,12,17-18H,1-5,7,9H2.
What are the key properties of N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 260.30 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(piperidin-2-ylmethyl)-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 162597458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).