About 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol
1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol (PubChem CID 162597694) has the molecular formula C9H10F4O2
and a molecular weight of 226.17 g/mol. Its IUPAC name is 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol |
| PubChem CID | 162597694 |
| Molecular Formula | C9H10F4O2 |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol |
| SMILES | CC(O)C1C=CC(OC(F)(F)F)=CC1F |
| InChI | InChI=1S/C9H10F4O2/c1-5(14)7-3-2-6(4-8(7)10)15-9(11,12)13/h2-5,7-8,14H,1H3 |
| InChIKey | XMFPCTBQZGHFPA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol?
The IUPAC name of 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol (CID 162597694) is 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol.
What is the SMILES notation for 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol?
The canonical SMILES for 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol is CC(O)C1C=CC(OC(F)(F)F)=CC1F.
What is the InChIKey of 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol?
The InChIKey is XMFPCTBQZGHFPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F4O2/c1-5(14)7-3-2-6(4-8(7)10)15-9(11,12)13/h2-5,7-8,14H,1H3.
What are the key properties of 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol?
1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol has a molecular weight of 226.17 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]ethanol is sourced from PubChem (CID 162597694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).