C7H9F5O4 — CID 162597981
4-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-dioxolan-2-ol (PubChem CID 162597981) has the molecular formula C7H9F5O4 and a molecular weight of 252.13 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-dioxolan-2-ol.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 162597981 |
| Molecular Formula | C7H9F5O4 |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-dioxolan-2-ol |
| SMILES | OC1OCC(COCC(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H9F5O4/c8-6(9,7(10,11)12)3-14-1-4-2-15-5(13)16-4/h4-5,13H,1-3H2 |
| InChIKey | HSTIAVMRQDGVNA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|