C24H23F2N2O4S+ — CID 162598113
CID 162598113 (PubChem CID 162598113) has the molecular formula C24H23F2N2O4S+ and a molecular weight of 473.52 g/mol.
| Compound Name | CID 162598113 |
|---|---|
| PubChem CID | 162598113 |
| Molecular Formula | C24H23F2N2O4S+ |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)c1ccc(CC(=O)Nc2ccc(C(F)(F)C(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22F2N2O4S/c1-2-33(31,32)21-14-8-17(9-15-21)16-22(29)27-20-12-10-18(11-13-20)24(25,26)23(30)28-19-6-4-3-5-7-19/h3-15H,2,16H2,1H3,(H2-,27,28,29,30,31,32)/p+1 |
| InChIKey | ZQJOYLCITAPPSK-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|