C26H34F3N3O3 — CID 162598248
2,2,2-trifluoro-N-[2-[3-(3-formyl-4,4-dimethylhexyl)cyclohexyl]-3-oxo-1H-isoindole-5-carboximidoyl]acetamide (PubChem CID 162598248) has the molecular formula C26H34F3N3O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[3-(3-formyl-4,4-dimethylhexyl)cyclohexyl]-3-oxo-1H-isoindole-5-carboximidoyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[3-(3-formyl-4,4-dimethylhexyl)cyclohexyl]-3-oxo-1H-isoindole-5-carboximidoyl]acetamide |
|---|---|
| PubChem CID | 162598248 |
| Molecular Formula | C26H34F3N3O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[3-(3-formyl-4,4-dimethylhexyl)cyclohexyl]-3-oxo-1H-isoindole-5-carboximidoyl]acetamide |
| SMILES | [H]/N=C(\NC(=O)C(F)(F)F)c1ccc2c(c1)C(=O)N(C1CCCC(CCC(C=O)C(C)(C)CC)C1)C2 |
| InChI | InChI=1S/C26H34F3N3O3/c1-4-25(2,3)19(15-33)11-8-16-6-5-7-20(12-16)32-14-18-10-9-17(13-21(18)23(32)34)22(30)31-24(35)26(27,28)29/h9-10,13,15-16,19-20H,4-8,11-12,14H2,1-3H3,(H2,30,31,35) |
| InChIKey | MFARKXSXFPPMPV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|