C20H20F3N5O2 — CID 162598278
3-[[5-methyl-5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazolidin-2-ylidene]amino]-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-2-one (PubChem CID 162598278) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 3-[[5-methyl-5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazolidin-2-ylidene]amino]-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-[[5-methyl-5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazolidin-2-ylidene]amino]-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 162598278 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[[5-methyl-5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazolidin-2-ylidene]amino]-5-phenyl-1,3,9,9a-tetrahydro-1,4-benzodiazepin-2-one |
| SMILES | CC1(CC(F)(F)F)NNC(=NC2N=C(c3ccccc3)C3=CC=CCC3NC2=O)O1 |
| InChI | InChI=1S/C20H20F3N5O2/c1-19(11-20(21,22)23)28-27-18(30-19)26-16-17(29)24-14-10-6-5-9-13(14)15(25-16)12-7-3-2-4-8-12/h2-9,14,16,28H,10-11H2,1H3,(H,24,29)(H,26,27) |
| InChIKey | OSAHZGOLQHWYFF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|