C8H14F2N2 — CID 162598593
1-[(4S)-4-(difluoromethyl)pyrrolidin-2-yl]-N-methylethenamine (PubChem CID 162598593) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-[(4S)-4-(difluoromethyl)pyrrolidin-2-yl]-N-methylethenamine.
| Compound Name | 1-[(4S)-4-(difluoromethyl)pyrrolidin-2-yl]-N-methylethenamine |
|---|---|
| PubChem CID | 162598593 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-[(4S)-4-(difluoromethyl)pyrrolidin-2-yl]-N-methylethenamine |
| SMILES | C=C(NC)C1C[C@H](C(F)F)CN1 |
| InChI | InChI=1S/C8H14F2N2/c1-5(11-2)7-3-6(4-12-7)8(9)10/h6-8,11-12H,1,3-4H2,2H3/t6-,7?/m0/s1 |
| InChIKey | APDGUBTYCNMCNU-PKPIPKONSA-N |
| XLogP | 0.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |