C10H16F4N2 — CID 162598669
1-[(1S,2S,6R)-4-fluoro-2,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-methylhydrazine (PubChem CID 162598669) has the molecular formula C10H16F4N2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 1-[(1S,2S,6R)-4-fluoro-2,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-methylhydrazine.
| Compound Name | 1-[(1S,2S,6R)-4-fluoro-2,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 162598669 |
| Molecular Formula | C10H16F4N2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-[(1S,2S,6R)-4-fluoro-2,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-methylhydrazine |
| SMILES | CNN[C@H]1[C@H](C)CC(F)=C(C(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C10H16F4N2/c1-5-4-7(11)8(10(12,13)14)6(2)9(5)16-15-3/h5-6,9,15-16H,4H2,1-3H3/t5-,6+,9+/m1/s1 |
| InChIKey | MUQUHBMHFMYHSF-JHEQGTHGSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|