About 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine
1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine (PubChem CID 162598837) has the molecular formula C12H17F3N2
and a molecular weight of 246.28 g/mol. Its IUPAC name is 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine.
Molecular Properties
| Compound Name | 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine |
| PubChem CID | 162598837 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine |
| SMILES | CN1CCN(C2=CCCC(C(F)(F)F)=C2)CC1 |
| InChI | InChI=1S/C12H17F3N2/c1-16-5-7-17(8-6-16)11-4-2-3-10(9-11)12(13,14)15/h4,9H,2-3,5-8H2,1H3 |
| InChIKey | GYHAMHMAUVPQAK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The IUPAC name of 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine (CID 162598837) is 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine.
What is the SMILES notation for 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The canonical SMILES for 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine is CN1CCN(C2=CCCC(C(F)(F)F)=C2)CC1.
What is the InChIKey of 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
The InChIKey is GYHAMHMAUVPQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2/c1-16-5-7-17(8-6-16)11-4-2-3-10(9-11)12(13,14)15/h4,9H,2-3,5-8H2,1H3.
What are the key properties of 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine?
1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine has a molecular weight of 246.28 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazine is sourced from PubChem (CID 162598837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).