About CID 162599103
CID 162599103 (PubChem CID 162599103) has the molecular formula C29H35BF3N5O
and a molecular weight of 537.44 g/mol.
Molecular Properties
| Compound Name | CID 162599103 |
| PubChem CID | 162599103 |
| Molecular Formula | C29H35BF3N5O |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCCCNC2CCC3(CC2)CC3Nc2nc(N(C)C)c3ccccc3n2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C29H35BF3N5O/c1-38(2)26-22-8-3-4-9-23(22)35-27(37-26)36-25-18-28(25)14-12-21(13-15-28)34-16-6-5-7-19-10-11-20(30)17-24(19)39-29(31,32)33/h3-4,8-11,17,21,25,34H,5-7,12-16,18H2,1-2H3,(H,35,36,37) |
| InChIKey | VLILQCYGEWMNKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162599103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162599103?
The IUPAC name of CID 162599103 (CID 162599103) is not available.
What is the SMILES notation for CID 162599103?
The canonical SMILES for CID 162599103 is [B]c1ccc(CCCCNC2CCC3(CC2)CC3Nc2nc(N(C)C)c3ccccc3n2)c(OC(F)(F)F)c1.
What is the InChIKey of CID 162599103?
The InChIKey is VLILQCYGEWMNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H35BF3N5O/c1-38(2)26-22-8-3-4-9-23(22)35-27(37-26)36-25-18-28(25)14-12-21(13-15-28)34-16-6-5-7-19-10-11-20(30)17-24(19)39-29(31,32)33/h3-4,8-11,17,21,25,34H,5-7,12-16,18H2,1-2H3,(H,35,36,37).
What are the key properties of CID 162599103?
CID 162599103 has a molecular weight of 537.44 g/mol, XLogP of 5.11, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162599103 is sourced from PubChem (CID 162599103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).