About (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol
(2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol (PubChem CID 162599261) has the molecular formula C6H10F2O3
and a molecular weight of 168.14 g/mol. Its IUPAC name is (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol.
Molecular Properties
| Compound Name | (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol |
| PubChem CID | 162599261 |
| Molecular Formula | C6H10F2O3 |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol |
| SMILES | OC[C@H]1OCC[C@H](O)C1(F)F |
| InChI | InChI=1S/C6H10F2O3/c7-6(8)4(10)1-2-11-5(6)3-9/h4-5,9-10H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | WFTDDUBPHNERRW-CRCLSJGQSA-N |
| XLogP | -0.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol?
The IUPAC name of (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol (CID 162599261) is (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol.
What is the SMILES notation for (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol?
The canonical SMILES for (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol is OC[C@H]1OCC[C@H](O)C1(F)F.
What is the InChIKey of (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol?
The InChIKey is WFTDDUBPHNERRW-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H10F2O3/c7-6(8)4(10)1-2-11-5(6)3-9/h4-5,9-10H,1-3H2/t4-,5+/m0/s1.
What are the key properties of (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol?
(2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol has a molecular weight of 168.14 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-3,3-difluoro-2-(hydroxymethyl)oxan-4-ol is sourced from PubChem (CID 162599261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).