C26H30ClF3INO2 — CID 162600083
(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-2-[(2S,3S)-3-iodo-2-methyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanol (PubChem CID 162600083) has the molecular formula C26H30ClF3INO2 and a molecular weight of 607.88 g/mol. Its IUPAC name is (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-2-[(2S,3S)-3-iodo-2-methyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanol.
| Compound Name | (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-2-[(2S,3S)-3-iodo-2-methyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 162600083 |
| Molecular Formula | C26H30ClF3INO2 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-2-[(2S,3S)-3-iodo-2-methyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanol |
| SMILES | C[C@@H]1N(C[C@H](O)C2(c3ccc(Cl)cc3)CCC2)CCC[C@@]1(I)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30ClF3INO2/c1-18-25(31,17-34-22-10-6-20(7-11-22)26(28,29)30)14-3-15-32(18)16-23(33)24(12-2-13-24)19-4-8-21(27)9-5-19/h4-11,18,23,33H,2-3,12-17H2,1H3/t18-,23-,25+/m0/s1 |
| InChIKey | JYQOTGQDMXIQNH-VVMVZBAXSA-N |
| XLogP | 6.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|